ChemNet > CAS > 64067-99-8 ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate
64067-99-8 ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate
| product Name |
ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate |
| CAS No |
64067-99-8 |
| Molecular Formula |
C9H8ClN3O2 |
| Molecular Weight |
225.6317 |
| InChI |
InChI=1/C9H8ClN3O2/c1-2-15-9(14)6-5-13-8(11-6)4-3-7(10)12-13/h3-5H,2H2,1H3 |
| Molecular Structure |
![64067-99-8 ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate](https://images-a.chemnet.com/suppliers/chembase/cas11/cas64067-99-8.gif)
|
| Density |
1.476g/cm3 |
| Melting point |
155℃ |
| Refractive index |
1.648 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
